1) LiOH lithium hydroxide 2) PBr3 phosphorus tribromide 3) Na2SO4 sodium sulfate 4) (NH4)2S ammonium sulfide 5) CaCO3 calcium carbonate 6) CF4 carbon tetrafluoride 7) NaNO3 sodium nitrate 8) P2S3 diphosphorus trisulfide 9) Al(NO3)3 aluminum nitrate 10) Mg(OH)2 magnesium hydroxide Write the formulas for the … MgSO4. Determine the empirical formula from the number of elements in a compound. 3 diphosphorus trisulfide 9) Al(NO 3) 3 aluminum nitrate 10) Mg(OH) 2 magnesium hydroxide Write the formulas for the following compounds. 11) potassium oxide K 2O 12) phosphorus tribromide PBr 3 13) calcium hydroxide … What is the correct molecular formula for the compound, carbon tetrabromide? calcium sulfide. A binary covalent compound is composed of two different elements (usually nonmetals). A sample of chloroform is found to contain 12.0 g of carbon, 106.4 g … I determined the bond type because there was no metal in the formula, and I determined the name by taking the prefixes of … With BH3, a dimeric adduct is produced:[3], InChI=1S/O6P4/c1-7-2-9-4-8(1)5-10(3-7)6-9, Except where otherwise noted, data are given for materials in their, "Tetracarbonyl(tetraphosphorus hexaoxide)iron", https://en.wikipedia.org/w/index.php?title=Phosphorus_trioxide&oldid=998272192, Pages using collapsible list with both background and text-align in titlestyle, Articles containing unverified chemical infoboxes, Creative Commons Attribution-ShareAlike License, This page was last edited on 4 January 2021, at 16:28. What is the correct molecular formula for the compound, boron trifluoride? What is the correct molecular formula for the compound, phosphorus pentachloride? Rule 1. What is the correct molecular formula for the compound, silicon tetrachloride? Search results for S4572 at Sigma-Aldrich. Compare Products: Select up to 4 products. Determine the formula of the product and justify your answer. Iron (III) chloride. Tetraphosphorus trisulfide. What is the correct molecular formula for the compound, arsenic pentafluoride? What is the correct molecular formula for the compound, dichlorine monoxide? What is the correct molecular formula for the compound, sulfur tetrafluoride? What is the correct name for the compound, ClO, What is the correct name for the compound, Cl, What is the correct name for the compound, PF. What is the correct molecular formula for the compound, sulfur dioxide? What is the correct molecular formula for the compound, dinitrogen trioxide? What is the correct molecular formula for the compound, nitrogen monoxide? What is the correct name for the compound, ClF? The Mole 87 Defining the Mole 87 Molar Mass 89 Interconverting Moles, Mass, and Number of Chemical Entities 90 Mass Percent from the Chemical Formula 93 3.2 3.3 Writing and Balancing Chemical Equations 101 3.4 Calculating Amounts of Reactant and Product 105 Determining the Formula of an Unknown Compound 94 What is the correct molecular formula for the compound, tetraphosphorus hexaoxide? Phosphorus trioxide is the chemical compound with the molecular formula P 4 O 6.Although the molecular formula suggests the name tetraphosphorus hexoxide, the name phosphorus trioxide preceded the knowledge of the compound's molecular structure, and its usage continues today. calcium sulfite. What is the correct molecular formula for the compound, antimony trichloride? What is the correct molecular formula for the compound, tetraphosphorus decasulfide? For example, a molecule of chlorine trifluoride, ClF, What is the correct name for the compound, AsF, What is the correct name for the compound, B, What is the correct name for the compound, BrF. What is the correct molecular formula for the compound, xenon difluoride? CaSO4. What is the correct name for FeCl3? What is the correct name for the compound, IF, What is the correct name for the compound, NF, What is the correct name for the compound, NO, What is the correct name for the compound, CF, What is the correct name for the compound, N, What is the correct name for the compound, P, What is the correct name for the compound, SeF, What is the correct name for the compound, PCl, What is the correct name for the compound, SF, What is the correct name for the compound, SO, What is the correct name for the compound, S, What is the correct name for the compound, XeF, What is the correct name for the compound, CS. Calculate the mass fraction of P in tetraphosphorus hexaoxide. *Please select more than one item to compare Fe(CO)4. What is the correct molecular formula for the compound, nitrogen trichloride? What is the correct molecular formula for the compound, tetraphosphorus trisulfide? What is the correct molecular formula for the compound, chlorine dioxide? What is the correct molecular formula for the compound, dinitrogen pentoxide. For example, a molecule of chlorine trifluoride, ClF 3 contains 1 atom of chlorine and 3 atoms of fluorine. [4] A binary covalent compound is composed of two different elements (usually nonmetals). calcium sulfate. What is the formula for magnesium sulfate? What is the correct molecular formula for the compound, dinitrogen dichloride? The primary use of arsenic … What is the correct molecular formula for the compound, tetraphosphorus decaoxide? Arsenic occurs in many minerals, usually in combination with sulfur and metals, but also as a pure elemental crystal.Arsenic is a metalloid.It has various allotropes, but only the gray form, which has a metallic appearance, is important to industry.. Remember, they may be either ionic or covalent compounds, so make sure you use the right method! What is the correct name for the compound, ICl? What is the correct molecular formula for the compound, selenium tetrafluoride? What is the correct molecular formula for the compound, chlorine monofluoride? What is the correct molecular formula for the compound, disulfur dichloride? Tetraphosphorus decaoxide, P4O10, forms the weaker acid H3PO4: P4O10 (s) ⫹ 6H2O(l) ±£ 4H3PO4 (aq) The oxide of the metalloid arsenic is weakly acidic, whereas that of the metalloid antimony is weakly basic. What is the correct molecular formula for the compound, xenon trioxide? Arsenic is a chemical element with the symbol As and atomic number 33. CaS. CaSO3. Academia.edu is a platform for academics to share research papers. What is the correct molecular formula for the compound, disulfur decafluoride?